Portugues
1. Description:
Icaridin is an insect repellent that is effective against a range of arthropods, including mosquitoes and ticks. It shows synergy with the non-pyrethroid insecticide propoxur both in killing and repelling mosquitoes. Icaridin and other insect repellents have been shown to act as either agonists or antagonists at insect olfactory receptors.
2. Specifications:
| Formal Name | 1-methylpropyl ester 2-(2-hydroxyethyl)-1-piperidinecarboxylic acid |
| CAS Number | 119515-38-7 |
| Synonyms | Bayrepel,Icaridin,KBR 3023,Saltidin™ |
| Appearance | Light yellow transparent liquid |
| Purity(%) | ≥97 |
| Molecular Formula | C12H23NO3 |
| Formula Weight | 229.3 |
| PH（8.2g/100ml water） | 4~9 |
| Specific density(g/cm3,20℃) | 1.013~1.085 |
| Boiling point (℃) | ≥260 |
| Formulation | A neat oil |
| SMILES | O=C(OC(C)CC)N1C(CCO)CCCC1 |
